C18H10Br2F3NO2 — CID 72608344
3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one (PubChem CID 72608344) has the molecular formula C18H10Br2F3NO2 and a molecular weight of 489.09 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 72608344 |
| Molecular Formula | C18H10Br2F3NO2 |
| Molecular Weight | 489.09 g/mol |
| Exact Mass | 486.90 |
| IUPAC Name | 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-(2,2,2-trifluoroacetyl)-1H-indol-2-one |
| SMILES | Cc1c(Br)cc(C=C2C(=O)Nc3ccc(C(=O)C(F)(F)F)cc32)cc1Br |
| InChI | InChI=1S/C18H10Br2F3NO2/c1-8-13(19)5-9(6-14(8)20)4-12-11-7-10(16(25)18(21,22)23)2-3-15(11)24-17(12)26/h2-7H,1H3,(H,24,26) |
| InChIKey | CMDBSMVVETYXNU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.09 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|