C24H18Br2N2O2 — CID 59963991
(3Z)-N-benzyl-3-[(3,5-dibromo-4-methylphenyl)methylidene]-2-oxo-1H-indole-5-carboxamide (PubChem CID 59963991) has the molecular formula C24H18Br2N2O2 and a molecular weight of 526.23 g/mol. Its IUPAC name is (3Z)-N-benzyl-3-[(3,5-dibromo-4-methylphenyl)methylidene]-2-oxo-1H-indole-5-carboxamide.
| Compound Name | (3Z)-N-benzyl-3-[(3,5-dibromo-4-methylphenyl)methylidene]-2-oxo-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 59963991 |
| Molecular Formula | C24H18Br2N2O2 |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | (3Z)-N-benzyl-3-[(3,5-dibromo-4-methylphenyl)methylidene]-2-oxo-1H-indole-5-carboxamide |
| SMILES | Cc1c(Br)cc(/C=C2\C(=O)Nc3ccc(C(=O)NCc4ccccc4)cc32)cc1Br |
| InChI | InChI=1S/C24H18Br2N2O2/c1-14-20(25)10-16(11-21(14)26)9-19-18-12-17(7-8-22(18)28-24(19)30)23(29)27-13-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,27,29)(H,28,30)/b19-9- |
| InChIKey | MKOWLKRMBXFNSD-OCKHKDLRSA-N |
| XLogP | 5.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|