C23H16ClN3O3 — CID 91445615
3-[(4-chlorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide (PubChem CID 91445615) has the molecular formula C23H16ClN3O3 and a molecular weight of 417.85 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 91445615 |
| Molecular Formula | C23H16ClN3O3 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide |
| SMILES | O=C1Nc2ccc(C(=O)NCc3cccnc3)cc2C(=O)C1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClN3O3/c24-17-6-3-14(4-7-17)10-19-21(28)18-11-16(5-8-20(18)27-23(19)30)22(29)26-13-15-2-1-9-25-12-15/h1-12H,13H2,(H,26,29)(H,27,30) |
| InChIKey | CEGHHZAYPIZLKB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|