C33H35BN5O3 — CID 169174856
CID 169174856 (PubChem CID 169174856) has the molecular formula C33H35BN5O3 and a molecular weight of 560.49 g/mol.
| Compound Name | CID 169174856 |
|---|---|
| PubChem CID | 169174856 |
| Molecular Formula | C33H35BN5O3 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | — |
| SMILES | C[B]C.Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)NC(C)c4ccccc4)cc32)c(C)c1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C31H29N5O3.C2H6B/c1-18-27(34-20(3)28(18)31(39)33-17-21-8-7-13-32-16-21)15-25-24-14-23(11-12-26(24)36-30(25)38)29(37)35-19(2)22-9-5-4-6-10-22;1-3-2/h4-16,19,34H,17H2,1-3H3,(H,33,39)(H,35,37)(H,36,38);1-2H3/b25-15-; |
| InChIKey | GUIVJCABCPECMU-WMJMVBMNSA-N |
| XLogP | 5.73 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|