C31H31F3N5O5Si — CID 174116263
CID 174116263 (PubChem CID 174116263) has the molecular formula C31H31F3N5O5Si and a molecular weight of 638.70 g/mol.
| Compound Name | CID 174116263 |
|---|---|
| PubChem CID | 174116263 |
| Molecular Formula | C31H31F3N5O5Si |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | — |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@H](C)c4ccccc4)cc32)c(C)c1C(=O)N[Si]1CCCN(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C31H31F3N5O5Si/c1-17-25(35-19(3)26(17)29(42)38-45-13-7-12-39(16-45)44-30(43)31(32,33)34)15-23-22-14-21(10-11-24(22)37-28(23)41)27(40)36-18(2)20-8-5-4-6-9-20/h4-6,8-11,14-15,18,35H,7,12-13,16H2,1-3H3,(H,36,40)(H,37,41)(H,38,42)/b23-15-/t18-/m1/s1 |
| InChIKey | WCRZKZKZIYMDBK-OYADDEIPSA-N |
| XLogP | 4.60 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|