C23H15ClFN3O3 — CID 91265313
3-[(4-chloro-3-fluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide (PubChem CID 91265313) has the molecular formula C23H15ClFN3O3 and a molecular weight of 435.84 g/mol. Its IUPAC name is 3-[(4-chloro-3-fluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide.
| Compound Name | 3-[(4-chloro-3-fluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 91265313 |
| Molecular Formula | C23H15ClFN3O3 |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 3-[(4-chloro-3-fluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-3-ylmethyl)-1H-quinoline-6-carboxamide |
| SMILES | O=C1Nc2ccc(C(=O)NCc3cccnc3)cc2C(=O)C1=Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C23H15ClFN3O3/c24-18-5-3-13(9-19(18)25)8-17-21(29)16-10-15(4-6-20(16)28-23(17)31)22(30)27-12-14-2-1-7-26-11-14/h1-11H,12H2,(H,27,30)(H,28,31) |
| InChIKey | CCBYTWRJTNUFHU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|