C21H12Cl2N2O3 — CID 54458166
3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(pyridine-3-carbonyl)-1H-indol-2-one (PubChem CID 54458166) has the molecular formula C21H12Cl2N2O3 and a molecular weight of 411.24 g/mol. Its IUPAC name is 3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(pyridine-3-carbonyl)-1H-indol-2-one.
| Compound Name | 3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(pyridine-3-carbonyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 54458166 |
| Molecular Formula | C21H12Cl2N2O3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(pyridine-3-carbonyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(=O)c3cccnc3)cc2C1=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C21H12Cl2N2O3/c22-16-7-11(8-17(23)20(16)27)6-15-14-9-12(3-4-18(14)25-21(15)28)19(26)13-2-1-5-24-10-13/h1-10,27H,(H,25,28) |
| InChIKey | WZRDVRNZPQORRK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|