C21H15ClN4O — CID 143823097
(3E)-3-[[3-amino-4-(pyridine-3-carboximidoyl)phenyl]methylidene]-5-chloro-1H-indol-2-one (PubChem CID 143823097) has the molecular formula C21H15ClN4O and a molecular weight of 374.83 g/mol. Its IUPAC name is (3E)-3-[[3-amino-4-(pyridine-3-carboximidoyl)phenyl]methylidene]-5-chloro-1H-indol-2-one.
| Compound Name | (3E)-3-[[3-amino-4-(pyridine-3-carboximidoyl)phenyl]methylidene]-5-chloro-1H-indol-2-one |
|---|---|
| PubChem CID | 143823097 |
| Molecular Formula | C21H15ClN4O |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (3E)-3-[[3-amino-4-(pyridine-3-carboximidoyl)phenyl]methylidene]-5-chloro-1H-indol-2-one |
| SMILES | [H]/N=C(\c1cccnc1)c1ccc(/C=C2/C(=O)Nc3ccc(Cl)cc32)cc1N |
| InChI | InChI=1S/C21H15ClN4O/c22-14-4-6-19-16(10-14)17(21(27)26-19)8-12-3-5-15(18(23)9-12)20(24)13-2-1-7-25-11-13/h1-11,24H,23H2,(H,26,27)/b17-8+,24-20+ |
| InChIKey | HNPFTACUEBKEMI-JUJIDLIQSA-N |
| XLogP | 4.23 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|