C16H9ClF3NO2 — CID 71245718
(3E)-5-chloro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one (PubChem CID 71245718) has the molecular formula C16H9ClF3NO2 and a molecular weight of 339.70 g/mol. Its IUPAC name is (3E)-5-chloro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 71245718 |
| Molecular Formula | C16H9ClF3NO2 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (3E)-5-chloro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2/C1=C\c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H9ClF3NO2/c17-10-4-5-14-12(8-10)13(15(22)21-14)7-9-2-1-3-11(6-9)23-16(18,19)20/h1-8H,(H,21,22)/b13-7+ |
| InChIKey | KXSHMNZNYCPRMC-NTUHNPAUSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|