About (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one
(3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one (PubChem CID 71246048) has the molecular formula C16H8F5NO2
and a molecular weight of 341.24 g/mol. Its IUPAC name is (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
| PubChem CID | 71246048 |
| Molecular Formula | C16H8F5NO2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(F)c(F)c2/C1=C/c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F5NO2/c17-11-4-5-12-13(14(11)18)10(15(23)22-12)7-8-2-1-3-9(6-8)24-16(19,20)21/h1-7H,(H,22,23)/b10-7- |
| InChIKey | TZCCUBQVTHRPNZ-YFHOEESVSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one (CID 71246048) is (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one is O=C1Nc2ccc(F)c(F)c2/C1=C/c1cccc(OC(F)(F)F)c1.
What is the InChIKey of (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one?
The InChIKey is TZCCUBQVTHRPNZ-YFHOEESVSA-N. The full InChI is InChI=1S/C16H8F5NO2/c17-11-4-5-12-13(14(11)18)10(15(23)22-12)7-8-2-1-3-9(6-8)24-16(19,20)21/h1-7H,(H,22,23)/b10-7-.
What are the key properties of (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one?
(3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one has a molecular weight of 341.24 g/mol, XLogP of 4.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one is sourced from PubChem (CID 71246048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).