C16H8F5NO2 — CID 71246048
(3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one (PubChem CID 71246048) has the molecular formula C16H8F5NO2 and a molecular weight of 341.24 g/mol. Its IUPAC name is (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 71246048 |
| Molecular Formula | C16H8F5NO2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (3Z)-4,5-difluoro-3-[[3-(trifluoromethoxy)phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(F)c(F)c2/C1=C/c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F5NO2/c17-11-4-5-12-13(14(11)18)10(15(23)22-12)7-8-2-1-3-9(6-8)24-16(19,20)21/h1-7H,(H,22,23)/b10-7- |
| InChIKey | TZCCUBQVTHRPNZ-YFHOEESVSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|