C17H13F2NO3 — CID 11220824
(3E)-3-[(2,5-dimethoxyphenyl)methylidene]-4,5-difluoro-1H-indol-2-one (PubChem CID 11220824) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is (3E)-3-[(2,5-dimethoxyphenyl)methylidene]-4,5-difluoro-1H-indol-2-one.
| Compound Name | (3E)-3-[(2,5-dimethoxyphenyl)methylidene]-4,5-difluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 11220824 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (3E)-3-[(2,5-dimethoxyphenyl)methylidene]-4,5-difluoro-1H-indol-2-one |
| SMILES | COc1ccc(OC)c(/C=C2/C(=O)Nc3ccc(F)c(F)c32)c1 |
| InChI | InChI=1S/C17H13F2NO3/c1-22-10-3-6-14(23-2)9(7-10)8-11-15-13(20-17(11)21)5-4-12(18)16(15)19/h3-8H,1-2H3,(H,20,21)/b11-8+ |
| InChIKey | SJWBASYYSSYQLY-DHZHZOJOSA-N |
| XLogP | 3.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|