About 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one
7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 69453878) has the molecular formula C17H14BrNO3
and a molecular weight of 360.21 g/mol. Its IUPAC name is 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
| PubChem CID | 69453878 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccc(OC)c(C=C2C(=O)Nc3c(Br)cccc32)c1 |
| InChI | InChI=1S/C17H14BrNO3/c1-21-11-6-7-15(22-2)10(8-11)9-13-12-4-3-5-14(18)16(12)19-17(13)20/h3-9H,1-2H3,(H,19,20) |
| InChIKey | NJIZDLRDQIDFIK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one?
The IUPAC name of 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one (CID 69453878) is 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one.
What is the SMILES notation for 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one?
The canonical SMILES for 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one is COc1ccc(OC)c(C=C2C(=O)Nc3c(Br)cccc32)c1.
What is the InChIKey of 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one?
The InChIKey is NJIZDLRDQIDFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO3/c1-21-11-6-7-15(22-2)10(8-11)9-13-12-4-3-5-14(18)16(12)19-17(13)20/h3-9H,1-2H3,(H,19,20).
What are the key properties of 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one?
7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one has a molecular weight of 360.21 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one is sourced from PubChem (CID 69453878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).