C17H14BrNO3 — CID 69453878
7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 69453878) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 69453878 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 7-bromo-3-[(2,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccc(OC)c(C=C2C(=O)Nc3c(Br)cccc32)c1 |
| InChI | InChI=1S/C17H14BrNO3/c1-21-11-6-7-15(22-2)10(8-11)9-13-12-4-3-5-14(18)16(12)19-17(13)20/h3-9H,1-2H3,(H,19,20) |
| InChIKey | NJIZDLRDQIDFIK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|