C16H11Br2NO2 — CID 57117105
5,7-dibromo-3-[(4-methoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 57117105) has the molecular formula C16H11Br2NO2 and a molecular weight of 409.08 g/mol. Its IUPAC name is 5,7-dibromo-3-[(4-methoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(4-methoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57117105 |
| Molecular Formula | C16H11Br2NO2 |
| Molecular Weight | 409.08 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 5,7-dibromo-3-[(4-methoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccc(C=C2C(=O)Nc3c(Br)cc(Br)cc32)cc1 |
| InChI | InChI=1S/C16H11Br2NO2/c1-21-11-4-2-9(3-5-11)6-13-12-7-10(17)8-14(18)15(12)19-16(13)20/h2-8H,1H3,(H,19,20) |
| InChIKey | NDPOMAKONBCLNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.08 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|