C20H20Br2N2O2 — CID 57132554
5,7-dibromo-3-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 57132554) has the molecular formula C20H20Br2N2O2 and a molecular weight of 480.20 g/mol. Its IUPAC name is 5,7-dibromo-3-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57132554 |
| Molecular Formula | C20H20Br2N2O2 |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | 5,7-dibromo-3-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | CN(C)CCCOc1ccc(C=C2C(=O)Nc3c(Br)cc(Br)cc32)cc1 |
| InChI | InChI=1S/C20H20Br2N2O2/c1-24(2)8-3-9-26-15-6-4-13(5-7-15)10-17-16-11-14(21)12-18(22)19(16)23-20(17)25/h4-7,10-12H,3,8-9H2,1-2H3,(H,23,25) |
| InChIKey | AMUCTECSKLVVIG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|