C19H17Br2NO2 — CID 57207669
5,7-dibromo-4-methyl-3-[(4-propoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 57207669) has the molecular formula C19H17Br2NO2 and a molecular weight of 451.16 g/mol. Its IUPAC name is 5,7-dibromo-4-methyl-3-[(4-propoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-4-methyl-3-[(4-propoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57207669 |
| Molecular Formula | C19H17Br2NO2 |
| Molecular Weight | 451.16 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | 5,7-dibromo-4-methyl-3-[(4-propoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | CCCOc1ccc(C=C2C(=O)Nc3c(Br)cc(Br)c(C)c32)cc1 |
| InChI | InChI=1S/C19H17Br2NO2/c1-3-8-24-13-6-4-12(5-7-13)9-14-17-11(2)15(20)10-16(21)18(17)22-19(14)23/h4-7,9-10H,3,8H2,1-2H3,(H,22,23) |
| InChIKey | AVOMNEQTOSWNCB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|