C18H15Br2NO2 — CID 57090983
5,7-dibromo-3-[(2-ethoxyphenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57090983) has the molecular formula C18H15Br2NO2 and a molecular weight of 437.13 g/mol. Its IUPAC name is 5,7-dibromo-3-[(2-ethoxyphenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(2-ethoxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57090983 |
| Molecular Formula | C18H15Br2NO2 |
| Molecular Weight | 437.13 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | 5,7-dibromo-3-[(2-ethoxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | CCOc1ccccc1C=C1C(=O)Nc2c(Br)cc(Br)c(C)c21 |
| InChI | InChI=1S/C18H15Br2NO2/c1-3-23-15-7-5-4-6-11(15)8-12-16-10(2)13(19)9-14(20)17(16)21-18(12)22/h4-9H,3H2,1-2H3,(H,21,22) |
| InChIKey | DFUVALSNDXZEOB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.13 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|