C16H10Br2ClNO — CID 57305680
5,7-dibromo-3-[(3-chlorophenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57305680) has the molecular formula C16H10Br2ClNO and a molecular weight of 427.52 g/mol. Its IUPAC name is 5,7-dibromo-3-[(3-chlorophenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(3-chlorophenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57305680 |
| Molecular Formula | C16H10Br2ClNO |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 424.88 |
| IUPAC Name | 5,7-dibromo-3-[(3-chlorophenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | Cc1c(Br)cc(Br)c2c1C(=Cc1cccc(Cl)c1)C(=O)N2 |
| InChI | InChI=1S/C16H10Br2ClNO/c1-8-12(17)7-13(18)15-14(8)11(16(21)20-15)6-9-3-2-4-10(19)5-9/h2-7H,1H3,(H,20,21) |
| InChIKey | YQQPIHBLPANIIF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|