C21H20Br2N2O4 — CID 57121314
5,7-dibromo-3-[(3-tert-butyl-4-methoxy-5-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57121314) has the molecular formula C21H20Br2N2O4 and a molecular weight of 524.21 g/mol. Its IUPAC name is 5,7-dibromo-3-[(3-tert-butyl-4-methoxy-5-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(3-tert-butyl-4-methoxy-5-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57121314 |
| Molecular Formula | C21H20Br2N2O4 |
| Molecular Weight | 524.21 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | 5,7-dibromo-3-[(3-tert-butyl-4-methoxy-5-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | COc1c([N+](=O)[O-])cc(C=C2C(=O)Nc3c(Br)cc(Br)c(C)c32)cc1C(C)(C)C |
| InChI | InChI=1S/C21H20Br2N2O4/c1-10-14(22)9-15(23)18-17(10)12(20(26)24-18)6-11-7-13(21(2,3)4)19(29-5)16(8-11)25(27)28/h6-9H,1-5H3,(H,24,26) |
| InChIKey | SLYHDZDFMQUMIX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.21 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|