C18H18Br2N2O — CID 57297089
5,7-dibromo-3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57297089) has the molecular formula C18H18Br2N2O and a molecular weight of 438.16 g/mol. Its IUPAC name is 5,7-dibromo-3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57297089 |
| Molecular Formula | C18H18Br2N2O |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 5,7-dibromo-3-[(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | CCc1c(C)[nH]c(C=C2C(=O)Nc3c(Br)cc(Br)c(C)c32)c1C |
| InChI | InChI=1S/C18H18Br2N2O/c1-5-11-8(2)15(21-10(11)4)6-12-16-9(3)13(19)7-14(20)17(16)22-18(12)23/h6-7,21H,5H2,1-4H3,(H,22,23) |
| InChIKey | FJRQYCYCOXLJLC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|