C18H19BrN2O — CID 69418090
5-bromo-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 69418090) has the molecular formula C18H19BrN2O and a molecular weight of 359.27 g/mol. Its IUPAC name is 5-bromo-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5-bromo-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 69418090 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 5-bromo-3-[(3,5-diethyl-1H-pyrrol-2-yl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | CCc1cc(CC)c(C=C2C(=O)Nc3ccc(Br)c(C)c32)[nH]1 |
| InChI | InChI=1S/C18H19BrN2O/c1-4-11-8-12(5-2)20-16(11)9-13-17-10(3)14(19)6-7-15(17)21-18(13)22/h6-9,20H,4-5H2,1-3H3,(H,21,22) |
| InChIKey | ZDVBZAJZBGWFMM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|