C19H19BrN2O — CID 57067741
5-bromo-4-methyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57067741) has the molecular formula C19H19BrN2O and a molecular weight of 371.28 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-4-methyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57067741 |
| Molecular Formula | C19H19BrN2O |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-bromo-4-methyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1c(C=C2C(=O)Nc3ccc(Br)c(C)c32)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C19H19BrN2O/c1-10-12-5-3-4-6-15(12)21-17(10)9-13-18-11(2)14(20)7-8-16(18)22-19(13)23/h7-9,21H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | QWMZSGKOPJZNOW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|