C15H12BrNOS2 — CID 57303692
5-bromo-4-methyl-3-[(5-methylsulfanylthiophen-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57303692) has the molecular formula C15H12BrNOS2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-[(5-methylsulfanylthiophen-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-4-methyl-3-[(5-methylsulfanylthiophen-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57303692 |
| Molecular Formula | C15H12BrNOS2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 5-bromo-4-methyl-3-[(5-methylsulfanylthiophen-2-yl)methylidene]-1H-indol-2-one |
| SMILES | CSc1ccc(C=C2C(=O)Nc3ccc(Br)c(C)c32)s1 |
| InChI | InChI=1S/C15H12BrNOS2/c1-8-11(16)4-5-12-14(8)10(15(18)17-12)7-9-3-6-13(19-2)20-9/h3-7H,1-2H3,(H,17,18) |
| InChIKey | UQCFDMYIWQOTKV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|