C22H16BrNO — CID 57225450
5-bromo-4-methyl-3-[(4-phenylphenyl)methylidene]-1H-indol-2-one (PubChem CID 57225450) has the molecular formula C22H16BrNO and a molecular weight of 390.28 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-[(4-phenylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-4-methyl-3-[(4-phenylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57225450 |
| Molecular Formula | C22H16BrNO |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-bromo-4-methyl-3-[(4-phenylphenyl)methylidene]-1H-indol-2-one |
| SMILES | Cc1c(Br)ccc2c1C(=Cc1ccc(-c3ccccc3)cc1)C(=O)N2 |
| InChI | InChI=1S/C22H16BrNO/c1-14-19(23)11-12-20-21(14)18(22(25)24-20)13-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h2-13H,1H3,(H,24,25) |
| InChIKey | JJFSWBPSEXBNTB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|