C16H10Br2ClNO2 — CID 57099549
5-bromo-3-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57099549) has the molecular formula C16H10Br2ClNO2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 5-bromo-3-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5-bromo-3-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57099549 |
| Molecular Formula | C16H10Br2ClNO2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 440.88 |
| IUPAC Name | 5-bromo-3-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | Cc1c(Br)ccc2c1C(=Cc1cc(Cl)cc(Br)c1O)C(=O)N2 |
| InChI | InChI=1S/C16H10Br2ClNO2/c1-7-11(17)2-3-13-14(7)10(16(22)20-13)5-8-4-9(19)6-12(18)15(8)21/h2-6,21H,1H3,(H,20,22) |
| InChIKey | HVOBITHTQPVVFU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|