C10H5BrClNO3S — CID 1379615
(5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1379615) has the molecular formula C10H5BrClNO3S and a molecular weight of 334.58 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1379615 |
| Molecular Formula | C10H5BrClNO3S |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 332.89 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(Cl)cc(Br)c2O)S1 |
| InChI | InChI=1S/C10H5BrClNO3S/c11-6-3-5(12)1-4(8(6)14)2-7-9(15)13-10(16)17-7/h1-3,14H,(H,13,15,16)/b7-2- |
| InChIKey | MQHNNWACZDZXIP-UQCOIBPSSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|