C11H8BrNO3S — CID 134141271
(5Z)-5-[(2-bromo-5-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 134141271) has the molecular formula C11H8BrNO3S and a molecular weight of 314.16 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-5-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-bromo-5-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 134141271 |
| Molecular Formula | C11H8BrNO3S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | (5Z)-5-[(2-bromo-5-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Br)c(/C=C2\SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H8BrNO3S/c1-16-7-2-3-8(12)6(4-7)5-9-10(14)13-11(15)17-9/h2-5H,1H3,(H,13,14,15)/b9-5- |
| InChIKey | RMVKFTNGZFBFRO-UITAMQMPSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|