C21H18N2O4S — CID 85074620
5-[[4-[2-(5-methoxy-1H-indol-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 85074620) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 5-[[4-[2-(5-methoxy-1H-indol-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(5-methoxy-1H-indol-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 85074620 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-[[4-[2-(5-methoxy-1H-indol-3-yl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc2[nH]cc(CCOc3ccc(C=C4SC(=O)NC4=O)cc3)c2c1 |
| InChI | InChI=1S/C21H18N2O4S/c1-26-16-6-7-18-17(11-16)14(12-22-18)8-9-27-15-4-2-13(3-5-15)10-19-20(24)23-21(25)28-19/h2-7,10-12,22H,8-9H2,1H3,(H,23,24,25) |
| InChIKey | HPFULBWBPHLEGM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|