C19H16N2O5S — CID 123865531
5-[[4-[2-(3-methoxyphenyl)-2-nitrosoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123865531) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is 5-[[4-[2-(3-methoxyphenyl)-2-nitrosoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(3-methoxyphenyl)-2-nitrosoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123865531 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 5-[[4-[2-(3-methoxyphenyl)-2-nitrosoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc(C(COc2ccc(C=C3SC(=O)NC3=O)cc2)N=O)c1 |
| InChI | InChI=1S/C19H16N2O5S/c1-25-15-4-2-3-13(10-15)16(21-24)11-26-14-7-5-12(6-8-14)9-17-18(22)20-19(23)27-17/h2-10,16H,11H2,1H3,(H,20,22,23) |
| InChIKey | LUNSTDUUSJZTIN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|