C17H17BrClNO3S — CID 126132682
(5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-(cyclohexylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126132682) has the molecular formula C17H17BrClNO3S and a molecular weight of 430.75 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-(cyclohexylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-(cyclohexylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126132682 |
| Molecular Formula | C17H17BrClNO3S |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-(cyclohexylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc(Cl)cc(Br)c2O)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C17H17BrClNO3S/c18-13-8-12(19)6-11(15(13)21)7-14-16(22)20(17(23)24-14)9-10-4-2-1-3-5-10/h6-8,10,21H,1-5,9H2/b14-7+ |
| InChIKey | FNXAAXUUYGBYIO-VGOFMYFVSA-N |
| XLogP | 5.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|