C15H12BrNO2 — CID 57037010
5-bromo-4-methyl-3-[(5-methylfuran-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57037010) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-[(5-methylfuran-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-4-methyl-3-[(5-methylfuran-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57037010 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 5-bromo-4-methyl-3-[(5-methylfuran-2-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(C=C2C(=O)Nc3ccc(Br)c(C)c32)o1 |
| InChI | InChI=1S/C15H12BrNO2/c1-8-3-4-10(19-8)7-11-14-9(2)12(16)5-6-13(14)17-15(11)18/h3-7H,1-2H3,(H,17,18) |
| InChIKey | PSIKEYKPZOIXKJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|