C21H21Br2NO2 — CID 70000459
5,7-dibromo-3-[(3-tert-butyl-4-methoxyphenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 70000459) has the molecular formula C21H21Br2NO2 and a molecular weight of 479.21 g/mol. Its IUPAC name is 5,7-dibromo-3-[(3-tert-butyl-4-methoxyphenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(3-tert-butyl-4-methoxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 70000459 |
| Molecular Formula | C21H21Br2NO2 |
| Molecular Weight | 479.21 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | 5,7-dibromo-3-[(3-tert-butyl-4-methoxyphenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | COc1ccc(C=C2C(=O)Nc3c(Br)cc(Br)c(C)c32)cc1C(C)(C)C |
| InChI | InChI=1S/C21H21Br2NO2/c1-11-15(22)10-16(23)19-18(11)13(20(25)24-19)8-12-6-7-17(26-5)14(9-12)21(2,3)4/h6-10H,1-5H3,(H,24,25) |
| InChIKey | FXDSRLCNFNEOMD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.21 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|