C16H10Br2N2O4 — CID 57021361
5,7-dibromo-3-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one (PubChem CID 57021361) has the molecular formula C16H10Br2N2O4 and a molecular weight of 454.07 g/mol. Its IUPAC name is 5,7-dibromo-3-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57021361 |
| Molecular Formula | C16H10Br2N2O4 |
| Molecular Weight | 454.07 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 5,7-dibromo-3-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methyl-1H-indol-2-one |
| SMILES | Cc1c(Br)cc(Br)c2c1C(=Cc1ccc([N+](=O)[O-])c(O)c1)C(=O)N2 |
| InChI | InChI=1S/C16H10Br2N2O4/c1-7-10(17)6-11(18)15-14(7)9(16(22)19-15)4-8-2-3-12(20(23)24)13(21)5-8/h2-6,21H,1H3,(H,19,22) |
| InChIKey | WZLIGSVRZPSRCC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.07 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|