C15H7Br2ClN2O3 — CID 57229658
5,7-dibromo-3-[(4-chloro-3-nitrophenyl)methylidene]-1H-indol-2-one (PubChem CID 57229658) has the molecular formula C15H7Br2ClN2O3 and a molecular weight of 458.49 g/mol. Its IUPAC name is 5,7-dibromo-3-[(4-chloro-3-nitrophenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(4-chloro-3-nitrophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57229658 |
| Molecular Formula | C15H7Br2ClN2O3 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 455.85 |
| IUPAC Name | 5,7-dibromo-3-[(4-chloro-3-nitrophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2c(Br)cc(Br)cc2C1=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H7Br2ClN2O3/c16-8-5-9-10(15(21)19-14(9)11(17)6-8)3-7-1-2-12(18)13(4-7)20(22)23/h1-6H,(H,19,21) |
| InChIKey | VWERYXTVVDENQQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|