C15H8Br2FNO — CID 26366641
(3Z)-5,7-dibromo-3-[(2-fluorophenyl)methylidene]-1H-indol-2-one (PubChem CID 26366641) has the molecular formula C15H8Br2FNO and a molecular weight of 397.04 g/mol. Its IUPAC name is (3Z)-5,7-dibromo-3-[(2-fluorophenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5,7-dibromo-3-[(2-fluorophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 26366641 |
| Molecular Formula | C15H8Br2FNO |
| Molecular Weight | 397.04 g/mol |
| Exact Mass | 394.90 |
| IUPAC Name | (3Z)-5,7-dibromo-3-[(2-fluorophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2c(Br)cc(Br)cc2/C1=C/c1ccccc1F |
| InChI | InChI=1S/C15H8Br2FNO/c16-9-6-10-11(5-8-3-1-2-4-13(8)18)15(20)19-14(10)12(17)7-9/h1-7H,(H,19,20)/b11-5- |
| InChIKey | QZZAMSURXBEQJE-WZUFQYTHSA-N |
| XLogP | 4.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|