C15H10FNO3 — CID 143061978
(3E)-3-[(2,5-dihydroxyphenyl)methylidene]-7-fluoro-1H-indol-2-one (PubChem CID 143061978) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-7-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-7-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 143061978 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-7-fluoro-1H-indol-2-one |
| SMILES | O=C1Nc2c(F)cccc2/C1=C\c1cc(O)ccc1O |
| InChI | InChI=1S/C15H10FNO3/c16-12-3-1-2-10-11(15(20)17-14(10)12)7-8-6-9(18)4-5-13(8)19/h1-7,18-19H,(H,17,20)/b11-7+ |
| InChIKey | AFVUKQWUQCJDRJ-YRNVUSSQSA-N |
| XLogP | 2.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|