About (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one
(3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 143061968) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one |
| PubChem CID | 143061968 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | Nc1ccc2c(c1)/C(=C\c1cc(O)ccc1O)C(=O)N2 |
| InChI | InChI=1S/C15H12N2O3/c16-9-1-3-13-11(7-9)12(15(20)17-13)6-8-5-10(18)2-4-14(8)19/h1-7,18-19H,16H2,(H,17,20)/b12-6+ |
| InChIKey | XEDQYIPXVCAGGI-WUXMJOGZSA-N |
| XLogP | 2.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one?
The IUPAC name of (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one (CID 143061968) is (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one.
What is the SMILES notation for (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one?
The canonical SMILES for (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one is Nc1ccc2c(c1)/C(=C\c1cc(O)ccc1O)C(=O)N2.
What is the InChIKey of (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one?
The InChIKey is XEDQYIPXVCAGGI-WUXMJOGZSA-N. The full InChI is InChI=1S/C15H12N2O3/c16-9-1-3-13-11(7-9)12(15(20)17-13)6-8-5-10(18)2-4-14(8)19/h1-7,18-19H,16H2,(H,17,20)/b12-6+.
What are the key properties of (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one?
(3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one has a molecular weight of 268.27 g/mol, XLogP of 2.17, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-amino-3-[(2,5-dihydroxyphenyl)methylidene]-1H-indol-2-one is sourced from PubChem (CID 143061968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).