C16H14N2O5S — CID 57257956
3-[(2,4-dihydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 57257956) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57257956 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1ccc(O)cc1O)C(=O)N2 |
| InChI | InChI=1S/C16H14N2O5S/c1-17-24(22,23)11-4-5-14-12(8-11)13(16(21)18-14)6-9-2-3-10(19)7-15(9)20/h2-8,17,19-20H,1H3,(H,18,21) |
| InChIKey | HIRKYEWJFUVKHK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|