C14H12N2O3S2 — CID 57148124
N-methyl-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indole-5-sulfonamide (PubChem CID 57148124) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-methyl-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indole-5-sulfonamide.
| Compound Name | N-methyl-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57148124 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-methyl-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1cccs1)C(=O)N2 |
| InChI | InChI=1S/C14H12N2O3S2/c1-15-21(18,19)10-4-5-13-11(8-10)12(14(17)16-13)7-9-3-2-6-20-9/h2-8,15H,1H3,(H,16,17) |
| InChIKey | CUUSDIZIYOQEPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|