C14H12N4O5S — CID 58779576
(3Z)-N-methyl-3-[(3-nitro-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 58779576) has the molecular formula C14H12N4O5S and a molecular weight of 348.34 g/mol. Its IUPAC name is (3Z)-N-methyl-3-[(3-nitro-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3Z)-N-methyl-3-[(3-nitro-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 58779576 |
| Molecular Formula | C14H12N4O5S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (3Z)-N-methyl-3-[(3-nitro-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)/C(=C/c1[nH]ccc1[N+](=O)[O-])C(=O)N2 |
| InChI | InChI=1S/C14H12N4O5S/c1-15-24(22,23)8-2-3-11-9(6-8)10(14(19)17-11)7-12-13(18(20)21)4-5-16-12/h2-7,15-16H,1H3,(H,17,19)/b10-7- |
| InChIKey | FEIJBDBOKUKVPW-YFHOEESVSA-N |
| XLogP | 1.32 |
| TPSA | 134.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|