C16H13BrN2O4S — CID 57169992
3-[(5-bromo-2-hydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 57169992) has the molecular formula C16H13BrN2O4S and a molecular weight of 409.26 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57169992 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1cc(Br)ccc1O)C(=O)N2 |
| InChI | InChI=1S/C16H13BrN2O4S/c1-18-24(22,23)11-3-4-14-12(8-11)13(16(21)19-14)7-9-6-10(17)2-5-15(9)20/h2-8,18,20H,1H3,(H,19,21) |
| InChIKey | QBOZYTZQPHGALR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|