C22H14F3N3O6S — CID 57131963
3-[(2-hydroxy-5-nitrophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57131963) has the molecular formula C22H14F3N3O6S and a molecular weight of 505.43 g/mol. Its IUPAC name is 3-[(2-hydroxy-5-nitrophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(2-hydroxy-5-nitrophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57131963 |
| Molecular Formula | C22H14F3N3O6S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 3-[(2-hydroxy-5-nitrophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C22H14F3N3O6S/c23-22(24,25)13-1-3-14(4-2-13)27-35(33,34)16-6-7-19-17(11-16)18(21(30)26-19)10-12-9-15(28(31)32)5-8-20(12)29/h1-11,27,29H,(H,26,30) |
| InChIKey | TWBKJSDSLNTJBS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|