C21H15F3N2O4S — CID 57212134
3-[(5-methylfuran-2-yl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57212134) has the molecular formula C21H15F3N2O4S and a molecular weight of 448.42 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(5-methylfuran-2-yl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57212134 |
| Molecular Formula | C21H15F3N2O4S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | Cc1ccc(C=C2C(=O)Nc3ccc(S(=O)(=O)Nc4ccc(C(F)(F)F)cc4)cc32)o1 |
| InChI | InChI=1S/C21H15F3N2O4S/c1-12-2-7-15(30-12)10-18-17-11-16(8-9-19(17)25-20(18)27)31(28,29)26-14-5-3-13(4-6-14)21(22,23)24/h2-11,26H,1H3,(H,25,27) |
| InChIKey | RJDAGEDMOICOSI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|