C22H15F3N2O5S — CID 70001866
3-[(3,5-dihydroxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 70001866) has the molecular formula C22H15F3N2O5S and a molecular weight of 476.43 g/mol. Its IUPAC name is 3-[(3,5-dihydroxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(3,5-dihydroxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 70001866 |
| Molecular Formula | C22H15F3N2O5S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3-[(3,5-dihydroxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H15F3N2O5S/c23-22(24,25)13-1-3-14(4-2-13)27-33(31,32)17-5-6-20-18(11-17)19(21(30)26-20)9-12-7-15(28)10-16(29)8-12/h1-11,27-29H,(H,26,30) |
| InChIKey | HDQSKXUYXVVRGC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|