C20H13F3N2O4S — CID 57062180
3-(furan-2-ylmethylidene)-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57062180) has the molecular formula C20H13F3N2O4S and a molecular weight of 434.40 g/mol. Its IUPAC name is 3-(furan-2-ylmethylidene)-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-(furan-2-ylmethylidene)-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57062180 |
| Molecular Formula | C20H13F3N2O4S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 3-(furan-2-ylmethylidene)-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1ccco1 |
| InChI | InChI=1S/C20H13F3N2O4S/c21-20(22,23)12-3-5-13(6-4-12)25-30(27,28)15-7-8-18-16(11-15)17(19(26)24-18)10-14-2-1-9-29-14/h1-11,25H,(H,24,26) |
| InChIKey | FVSLLGGWPYHZFB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|