C22H13F5N2O3S — CID 57050513
3-[(2,4-difluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57050513) has the molecular formula C22H13F5N2O3S and a molecular weight of 480.41 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(2,4-difluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57050513 |
| Molecular Formula | C22H13F5N2O3S |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C22H13F5N2O3S/c23-14-4-1-12(19(24)10-14)9-18-17-11-16(7-8-20(17)28-21(18)30)33(31,32)29-15-5-2-13(3-6-15)22(25,26)27/h1-11,29H,(H,28,30) |
| InChIKey | BGCMCVHITRZPIT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|