C22H14F4N2O3S — CID 57305075
3-[(2-fluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57305075) has the molecular formula C22H14F4N2O3S and a molecular weight of 462.42 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(2-fluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57305075 |
| Molecular Formula | C22H14F4N2O3S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3-[(2-fluorophenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1ccccc1F |
| InChI | InChI=1S/C22H14F4N2O3S/c23-19-4-2-1-3-13(19)11-18-17-12-16(9-10-20(17)27-21(18)29)32(30,31)28-15-7-5-14(6-8-15)22(24,25)26/h1-12,28H,(H,27,29) |
| InChIKey | TZKQDCRETGSMMZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|