C28H19F3N2O4S — CID 57193715
2-oxo-3-[(3-phenoxyphenyl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57193715) has the molecular formula C28H19F3N2O4S and a molecular weight of 536.53 g/mol. Its IUPAC name is 2-oxo-3-[(3-phenoxyphenyl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 2-oxo-3-[(3-phenoxyphenyl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57193715 |
| Molecular Formula | C28H19F3N2O4S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-oxo-3-[(3-phenoxyphenyl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H19F3N2O4S/c29-28(30,31)19-9-11-20(12-10-19)33-38(35,36)23-13-14-26-24(17-23)25(27(34)32-26)16-18-5-4-8-22(15-18)37-21-6-2-1-3-7-21/h1-17,33H,(H,32,34) |
| InChIKey | JFGDLOJYBXFVPY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|