C25H22F3N3O4S — CID 57044958
3-[[4-(dimethylamino)-2-methoxyphenyl]methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57044958) has the molecular formula C25H22F3N3O4S and a molecular weight of 517.53 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-2-methoxyphenyl]methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[[4-(dimethylamino)-2-methoxyphenyl]methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57044958 |
| Molecular Formula | C25H22F3N3O4S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 3-[[4-(dimethylamino)-2-methoxyphenyl]methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | COc1cc(N(C)C)ccc1C=C1C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C25H22F3N3O4S/c1-31(2)18-9-4-15(23(13-18)35-3)12-21-20-14-19(10-11-22(20)29-24(21)32)36(33,34)30-17-7-5-16(6-8-17)25(26,27)28/h4-14,30H,1-3H3,(H,29,32) |
| InChIKey | RLJJWVWLZKWLRP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|