C25H21F3N2O6S — CID 57294666
2-oxo-N-[4-(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-sulfonamide (PubChem CID 57294666) has the molecular formula C25H21F3N2O6S and a molecular weight of 534.51 g/mol. Its IUPAC name is 2-oxo-N-[4-(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-sulfonamide.
| Compound Name | 2-oxo-N-[4-(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57294666 |
| Molecular Formula | C25H21F3N2O6S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 2-oxo-N-[4-(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-sulfonamide |
| SMILES | COc1cc(C=C2C(=O)Nc3ccc(S(=O)(=O)Nc4ccc(C(F)(F)F)cc4)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C25H21F3N2O6S/c1-34-21-11-14(12-22(35-2)23(21)36-3)10-19-18-13-17(8-9-20(18)29-24(19)31)37(32,33)30-16-6-4-15(5-7-16)25(26,27)28/h4-13,30H,1-3H3,(H,29,31) |
| InChIKey | FHDIOKQXVAPLKM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|