C18H16FNO4 — CID 3450009
5-fluoro-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 3450009) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 5-fluoro-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-fluoro-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 3450009 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-fluoro-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(C=C2C(=O)Nc3ccc(F)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C18H16FNO4/c1-22-15-7-10(8-16(23-2)17(15)24-3)6-13-12-9-11(19)4-5-14(12)20-18(13)21/h4-9H,1-3H3,(H,20,21) |
| InChIKey | XINISPIAUUKSSZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|